C10H13NO4 — CID 67296637
[3-hydroxy-3-(3-hydroxyphenyl)propyl]carbamic acid (PubChem CID 67296637) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is [3-hydroxy-3-(3-hydroxyphenyl)propyl]carbamic acid.
| Compound Name | [3-hydroxy-3-(3-hydroxyphenyl)propyl]carbamic acid |
|---|---|
| PubChem CID | 67296637 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [3-hydroxy-3-(3-hydroxyphenyl)propyl]carbamic acid |
| SMILES | O=C(O)NCCC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C10H13NO4/c12-8-3-1-2-7(6-8)9(13)4-5-11-10(14)15/h1-3,6,9,11-13H,4-5H2,(H,14,15) |
| InChIKey | UTRXVXMEVWDGPG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |