C11H15NO3 — CID 20616558
N-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]propanamide (PubChem CID 20616558) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]propanamide.
| Compound Name | N-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 20616558 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-[2-hydroxy-2-(3-hydroxyphenyl)ethyl]propanamide |
| SMILES | CCC(=O)NCC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C11H15NO3/c1-2-11(15)12-7-10(14)8-4-3-5-9(13)6-8/h3-6,10,13-14H,2,7H2,1H3,(H,12,15) |
| InChIKey | LMBHNPZYFLTVPD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |