About 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol
3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol (PubChem CID 7435960) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol.
Molecular Properties
| Compound Name | 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol |
| PubChem CID | 7435960 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol |
| SMILES | Cc1cc(C)nc(NC[C@@H](O)c2cccc(O)c2)n1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-6-10(2)17-14(16-9)15-8-13(19)11-4-3-5-12(18)7-11/h3-7,13,18-19H,8H2,1-2H3,(H,15,16,17)/t13-/m1/s1 |
| InChIKey | QPIQGPBSEWUFKJ-CYBMUJFWSA-N |
| XLogP | 1.94 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol?
The IUPAC name of 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol (CID 7435960) is 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol.
What is the SMILES notation for 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol?
The canonical SMILES for 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol is Cc1cc(C)nc(NC[C@@H](O)c2cccc(O)c2)n1.
What is the InChIKey of 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol?
The InChIKey is QPIQGPBSEWUFKJ-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-9-6-10(2)17-14(16-9)15-8-13(19)11-4-3-5-12(18)7-11/h3-7,13,18-19H,8H2,1-2H3,(H,15,16,17)/t13-/m1/s1.
What are the key properties of 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol?
3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol has a molecular weight of 259.31 g/mol, XLogP of 1.94, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-2-[(4,6-dimethylpyrimidin-2-yl)amino]-1-hydroxyethyl]phenol is sourced from PubChem (CID 7435960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).