3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid

C15H17N3O2 — CID 62876566

IUPAC3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid
SMILESCc1cc(C)nc(NCC(C(=O)O)c2ccccc2)n1
InChIInChI=1S/C15H17N3O2/c1-10-8-11(2)18-15(17-10)16-9-13(14(19)20)12-6-4-3-5-7-12/h3-8,13H,9H2,1-2H3,(H,19,20)(H,16,17,18)
InChIKeyRQWGPHYPIXSSAQ-UHFFFAOYSA-N
MW271.32 g/mol
LogP2.37
Rot. Bonds5

About 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid

3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid (PubChem CID 62876566) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid.

Molecular Properties

Compound Name3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid
PubChem CID62876566
Molecular FormulaC15H17N3O2
Molecular Weight271.32 g/mol
Exact Mass271.13
IUPAC Name3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid
SMILESCc1cc(C)nc(NCC(C(=O)O)c2ccccc2)n1
InChIInChI=1S/C15H17N3O2/c1-10-8-11(2)18-15(17-10)16-9-13(14(19)20)12-6-4-3-5-7-12/h3-8,13H,9H2,1-2H3,(H,19,20)(H,16,17,18)
InChIKeyRQWGPHYPIXSSAQ-UHFFFAOYSA-N
XLogP2.37
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.32
LogP ≤ 52.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid?
The IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid (CID 62876566) is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid.
What is the SMILES notation for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid?
The canonical SMILES for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid is Cc1cc(C)nc(NCC(C(=O)O)c2ccccc2)n1.
What is the InChIKey of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid?
The InChIKey is RQWGPHYPIXSSAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-10-8-11(2)18-15(17-10)16-9-13(14(19)20)12-6-4-3-5-7-12/h3-8,13H,9H2,1-2H3,(H,19,20)(H,16,17,18).
What are the key properties of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid?
3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid has a molecular weight of 271.32 g/mol, XLogP of 2.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid is sourced from PubChem (CID 62876566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).