3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid

C10H15N3O3 — CID 106108618

IUPAC3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid
SMILESCOC(CNc1nc(C)cc(C)n1)C(=O)O
InChIInChI=1S/C10H15N3O3/c1-6-4-7(2)13-10(12-6)11-5-8(16-3)9(14)15/h4,8H,5H2,1-3H3,(H,14,15)(H,11,12,13)
InChIKeyKHRLXNTVGBLAJU-UHFFFAOYSA-N
MW225.25 g/mol
LogP0.60
Rot. Bonds5

About 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid

3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid (PubChem CID 106108618) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid.

Molecular Properties

Compound Name3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid
PubChem CID106108618
Molecular FormulaC10H15N3O3
Molecular Weight225.25 g/mol
Exact Mass225.11
IUPAC Name3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid
SMILESCOC(CNc1nc(C)cc(C)n1)C(=O)O
InChIInChI=1S/C10H15N3O3/c1-6-4-7(2)13-10(12-6)11-5-8(16-3)9(14)15/h4,8H,5H2,1-3H3,(H,14,15)(H,11,12,13)
InChIKeyKHRLXNTVGBLAJU-UHFFFAOYSA-N
XLogP0.60
TPSA84.34 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid?
The IUPAC name of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid (CID 106108618) is 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid.
What is the SMILES notation for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid?
The canonical SMILES for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid is COC(CNc1nc(C)cc(C)n1)C(=O)O.
What is the InChIKey of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid?
The InChIKey is KHRLXNTVGBLAJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-6-4-7(2)13-10(12-6)11-5-8(16-3)9(14)15/h4,8H,5H2,1-3H3,(H,14,15)(H,11,12,13).
What are the key properties of 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid?
3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid has a molecular weight of 225.25 g/mol, XLogP of 0.60, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-methoxypropanoic acid is sourced from PubChem (CID 106108618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).