3-(2-ethylanilino)-2-phenylpropanoic acid

C17H19NO2 — CID 64566858

IUPAC3-(2-ethylanilino)-2-phenylpropanoic acid
SMILESCCc1ccccc1NCC(C(=O)O)c1ccccc1
InChIInChI=1S/C17H19NO2/c1-2-13-8-6-7-11-16(13)18-12-15(17(19)20)14-9-4-3-5-10-14/h3-11,15,18H,2,12H2,1H3,(H,19,20)
InChIKeyDNGMPCJWDHIZPG-UHFFFAOYSA-N
MW269.34 g/mol
LogP3.53
Rot. Bonds6

About 3-(2-ethylanilino)-2-phenylpropanoic acid

3-(2-ethylanilino)-2-phenylpropanoic acid (PubChem CID 64566858) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(2-ethylanilino)-2-phenylpropanoic acid.

Molecular Properties

Compound Name3-(2-ethylanilino)-2-phenylpropanoic acid
PubChem CID64566858
Molecular FormulaC17H19NO2
Molecular Weight269.34 g/mol
Exact Mass269.14
IUPAC Name3-(2-ethylanilino)-2-phenylpropanoic acid
SMILESCCc1ccccc1NCC(C(=O)O)c1ccccc1
InChIInChI=1S/C17H19NO2/c1-2-13-8-6-7-11-16(13)18-12-15(17(19)20)14-9-4-3-5-10-14/h3-11,15,18H,2,12H2,1H3,(H,19,20)
InChIKeyDNGMPCJWDHIZPG-UHFFFAOYSA-N
XLogP3.53
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.34
LogP ≤ 53.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2-ethylanilino)-2-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-3-(2-ethylanilino)propanoic acid
CID 103235875
3-(4-ethylanilino)-2-phenylpropanoic acid
CID 64566244
3-(3-ethylpentan-2-ylamino)-2-phenylpropanoic acid
CID 64559425
3-amino-N-(2-ethylphenyl)-2-phenylpropanamide
CID 62878156
3-(methylamino)-2-phenylpropanoic acid;hydrochloride
CID 134828159
3-[4-[4-[(2-carboxy-2-phenylethyl)amino]-3-methoxyphenyl]-2-methoxyanilino]-2-phenylpropanoic acid
CID 67981852
3-(5-chloro-2-methylanilino)-2-phenylpropanoic acid
CID 64566430
3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-phenylpropanoic acid
CID 62876566
2-phenyl-3-(2,3,3-trimethylbutanoylamino)propanoic acid
CID 120688095
3-(2-cyano-3-fluoroanilino)-2-phenylpropanoic acid
CID 64566700
2-phenyl-3-[[(1R)-1-phenylethyl]amino]propanoic acid
CID 78996615
3-(2,2-dimethylhydrazinyl)-2-phenylpropanoic acid
CID 83013948

Frequently Asked Questions

What is the IUPAC name of 3-(2-ethylanilino)-2-phenylpropanoic acid?
The IUPAC name of 3-(2-ethylanilino)-2-phenylpropanoic acid (CID 64566858) is 3-(2-ethylanilino)-2-phenylpropanoic acid.
What is the SMILES notation for 3-(2-ethylanilino)-2-phenylpropanoic acid?
The canonical SMILES for 3-(2-ethylanilino)-2-phenylpropanoic acid is CCc1ccccc1NCC(C(=O)O)c1ccccc1.
What is the InChIKey of 3-(2-ethylanilino)-2-phenylpropanoic acid?
The InChIKey is DNGMPCJWDHIZPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-2-13-8-6-7-11-16(13)18-12-15(17(19)20)14-9-4-3-5-10-14/h3-11,15,18H,2,12H2,1H3,(H,19,20).
What are the key properties of 3-(2-ethylanilino)-2-phenylpropanoic acid?
3-(2-ethylanilino)-2-phenylpropanoic acid has a molecular weight of 269.34 g/mol, XLogP of 3.53, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylanilino)-2-phenylpropanoic acid is sourced from PubChem (CID 64566858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).