C16H16ClNO2 — CID 64566430
3-(5-chloro-2-methylanilino)-2-phenylpropanoic acid (PubChem CID 64566430) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)-2-phenylpropanoic acid.
| Compound Name | 3-(5-chloro-2-methylanilino)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 64566430 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)-2-phenylpropanoic acid |
| SMILES | Cc1ccc(Cl)cc1NCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2/c1-11-7-8-13(17)9-15(11)18-10-14(16(19)20)12-5-3-2-4-6-12/h2-9,14,18H,10H2,1H3,(H,19,20) |
| InChIKey | IIYQDMAMHRGEEU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |