C10H14N2O3 — CID 90894433
[3-(3-aminophenyl)-1,1-dideuterio-3-hydroxypropyl]carbamic acid (PubChem CID 90894433) has the molecular formula C10H14N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is [3-(3-aminophenyl)-1,1-dideuterio-3-hydroxypropyl]carbamic acid.
| Compound Name | [3-(3-aminophenyl)-1,1-dideuterio-3-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 90894433 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | [3-(3-aminophenyl)-1,1-dideuterio-3-hydroxypropyl]carbamic acid |
| SMILES | [2H]C([2H])(CC(O)c1cccc(N)c1)NC(=O)O |
| InChI | InChI=1S/C10H14N2O3/c11-8-3-1-2-7(6-8)9(13)4-5-12-10(14)15/h1-3,6,9,12-13H,4-5,11H2,(H,14,15)/i5D2 |
| InChIKey | MQNCIIPFPPCGDX-BFWBPSQCSA-N |
| XLogP | 0.96 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|