C11H14F3NO — CID 106695875
1-(3-aminophenyl)-5,5,5-trifluoropentan-1-ol (PubChem CID 106695875) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-(3-aminophenyl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(3-aminophenyl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 106695875 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-(3-aminophenyl)-5,5,5-trifluoropentan-1-ol |
| SMILES | Nc1cccc(C(O)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO/c12-11(13,14)6-2-5-10(16)8-3-1-4-9(15)7-8/h1,3-4,7,10,16H,2,5-6,15H2 |
| InChIKey | WELGARKNHOBPLM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|