C12H12F3NO — CID 115515722
3-(5,5,5-trifluoro-1-hydroxypentyl)benzonitrile (PubChem CID 115515722) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 3-(5,5,5-trifluoro-1-hydroxypentyl)benzonitrile.
| Compound Name | 3-(5,5,5-trifluoro-1-hydroxypentyl)benzonitrile |
|---|---|
| PubChem CID | 115515722 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-(5,5,5-trifluoro-1-hydroxypentyl)benzonitrile |
| SMILES | N#Cc1cccc(C(O)CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO/c13-12(14,15)6-2-5-11(17)10-4-1-3-9(7-10)8-16/h1,3-4,7,11,17H,2,5-6H2 |
| InChIKey | ZWEDXNDVQGVZKM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |