C11H8F5NO — CID 156765987
3-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)benzonitrile (PubChem CID 156765987) has the molecular formula C11H8F5NO and a molecular weight of 265.18 g/mol. Its IUPAC name is 3-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)benzonitrile.
| Compound Name | 3-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)benzonitrile |
|---|---|
| PubChem CID | 156765987 |
| Molecular Formula | C11H8F5NO |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-(3,3,4,4,4-pentafluoro-1-hydroxybutyl)benzonitrile |
| SMILES | N#Cc1cccc(C(O)CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F5NO/c12-10(13,11(14,15)16)5-9(18)8-3-1-2-7(4-8)6-17/h1-4,9,18H,5H2 |
| InChIKey | NUVHOXHKOFUHNF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|