C13H10F7NO — CID 156764150
3-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)benzonitrile (PubChem CID 156764150) has the molecular formula C13H10F7NO and a molecular weight of 329.22 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)benzonitrile.
| Compound Name | 3-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)benzonitrile |
|---|---|
| PubChem CID | 156764150 |
| Molecular Formula | C13H10F7NO |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-(3,3,4,4,5,5,5-heptafluoro-1-methoxypentyl)benzonitrile |
| SMILES | COC(CC(F)(F)C(F)(F)C(F)(F)F)c1cccc(C#N)c1 |
| InChI | InChI=1S/C13H10F7NO/c1-22-10(9-4-2-3-8(5-9)7-21)6-11(14,15)12(16,17)13(18,19)20/h2-5,10H,6H2,1H3 |
| InChIKey | VGKSOWAIDFRFND-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|