C12H5ClF9N — CID 139245458
3-[1-chloro-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]benzonitrile (PubChem CID 139245458) has the molecular formula C12H5ClF9N and a molecular weight of 369.61 g/mol. Its IUPAC name is 3-[1-chloro-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]benzonitrile.
| Compound Name | 3-[1-chloro-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]benzonitrile |
|---|---|
| PubChem CID | 139245458 |
| Molecular Formula | C12H5ClF9N |
| Molecular Weight | 369.61 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 3-[1-chloro-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]benzonitrile |
| SMILES | N#Cc1cccc(C(Cl)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H5ClF9N/c13-8(7-3-1-2-6(4-7)5-23)9(10(14,15)16,11(17,18)19)12(20,21)22/h1-4,8H |
| InChIKey | NTISGYHDUSKFIP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|