C12H13F5O2 — CID 156763940
1-(3-ethoxyphenyl)-3,3,4,4,4-pentafluorobutan-1-ol (PubChem CID 156763940) has the molecular formula C12H13F5O2 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-3,3,4,4,4-pentafluorobutan-1-ol.
| Compound Name | 1-(3-ethoxyphenyl)-3,3,4,4,4-pentafluorobutan-1-ol |
|---|---|
| PubChem CID | 156763940 |
| Molecular Formula | C12H13F5O2 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(3-ethoxyphenyl)-3,3,4,4,4-pentafluorobutan-1-ol |
| SMILES | CCOc1cccc(C(O)CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F5O2/c1-2-19-9-5-3-4-8(6-9)10(18)7-11(13,14)12(15,16)17/h3-6,10,18H,2,7H2,1H3 |
| InChIKey | GXOOUJGYORYEJZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|