C13H15F5O2 — CID 156764220
3,3,4,4,4-pentafluoro-1-(3-propoxyphenyl)butan-1-ol (PubChem CID 156764220) has the molecular formula C13H15F5O2 and a molecular weight of 298.25 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-1-(3-propoxyphenyl)butan-1-ol.
| Compound Name | 3,3,4,4,4-pentafluoro-1-(3-propoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 156764220 |
| Molecular Formula | C13H15F5O2 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-1-(3-propoxyphenyl)butan-1-ol |
| SMILES | CCCOc1cccc(C(O)CC(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F5O2/c1-2-6-20-10-5-3-4-9(7-10)11(19)8-12(14,15)13(16,17)18/h3-5,7,11,19H,2,6,8H2,1H3 |
| InChIKey | PLXOQNVHIOWUSQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|