C14H13F3O — CID 64565521
4,4,4-trifluoro-1-naphthalen-2-ylbutan-1-ol (PubChem CID 64565521) has the molecular formula C14H13F3O and a molecular weight of 254.25 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-naphthalen-2-ylbutan-1-ol.
| Compound Name | 4,4,4-trifluoro-1-naphthalen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 64565521 |
| Molecular Formula | C14H13F3O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 4,4,4-trifluoro-1-naphthalen-2-ylbutan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H13F3O/c15-14(16,17)8-7-13(18)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13,18H,7-8H2 |
| InChIKey | XLHSKCVVCLCVKX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |