C13H12F3NO — CID 64566958
4,4,4-trifluoro-1-quinolin-6-ylbutan-1-ol (PubChem CID 64566958) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-quinolin-6-ylbutan-1-ol.
| Compound Name | 4,4,4-trifluoro-1-quinolin-6-ylbutan-1-ol |
|---|---|
| PubChem CID | 64566958 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4,4,4-trifluoro-1-quinolin-6-ylbutan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)6-5-12(18)10-3-4-11-9(8-10)2-1-7-17-11/h1-4,7-8,12,18H,5-6H2 |
| InChIKey | DURLUMLBEBQARU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |