C16H17F3O2 — CID 82783054
1-naphthalen-2-yl-2-(4,4,4-trifluorobutoxy)ethanol (PubChem CID 82783054) has the molecular formula C16H17F3O2 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-naphthalen-2-yl-2-(4,4,4-trifluorobutoxy)ethanol.
| Compound Name | 1-naphthalen-2-yl-2-(4,4,4-trifluorobutoxy)ethanol |
|---|---|
| PubChem CID | 82783054 |
| Molecular Formula | C16H17F3O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-naphthalen-2-yl-2-(4,4,4-trifluorobutoxy)ethanol |
| SMILES | OC(COCCCC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17F3O2/c17-16(18,19)8-3-9-21-11-15(20)14-7-6-12-4-1-2-5-13(12)10-14/h1-2,4-7,10,15,20H,3,8-9,11H2 |
| InChIKey | GIRMKVOHDAMIAE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|