C16H18F3NO — CID 82781742
1-naphthalen-1-yl-2-(4,4,4-trifluorobutoxy)ethanamine (PubChem CID 82781742) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is 1-naphthalen-1-yl-2-(4,4,4-trifluorobutoxy)ethanamine.
| Compound Name | 1-naphthalen-1-yl-2-(4,4,4-trifluorobutoxy)ethanamine |
|---|---|
| PubChem CID | 82781742 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-naphthalen-1-yl-2-(4,4,4-trifluorobutoxy)ethanamine |
| SMILES | NC(COCCCC(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H18F3NO/c17-16(18,19)9-4-10-21-11-15(20)14-8-3-6-12-5-1-2-7-13(12)14/h1-3,5-8,15H,4,9-11,20H2 |
| InChIKey | KXLWGYDOAMSUMG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|