C14H20F3NO2 — CID 82790189
1-(2-ethoxyphenyl)-2-(4,4,4-trifluorobutoxy)ethanamine (PubChem CID 82790189) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-2-(4,4,4-trifluorobutoxy)ethanamine.
| Compound Name | 1-(2-ethoxyphenyl)-2-(4,4,4-trifluorobutoxy)ethanamine |
|---|---|
| PubChem CID | 82790189 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-(2-ethoxyphenyl)-2-(4,4,4-trifluorobutoxy)ethanamine |
| SMILES | CCOc1ccccc1C(N)COCCCC(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2/c1-2-20-13-7-4-3-6-11(13)12(18)10-19-9-5-8-14(15,16)17/h3-4,6-7,12H,2,5,8-10,18H2,1H3 |
| InChIKey | GEYINRHDDAYNLV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|