C18H25NO — CID 66234275
2-(3,3-dimethylbutoxy)-1-naphthalen-2-ylethanamine (PubChem CID 66234275) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-1-naphthalen-2-ylethanamine.
| Compound Name | 2-(3,3-dimethylbutoxy)-1-naphthalen-2-ylethanamine |
|---|---|
| PubChem CID | 66234275 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-1-naphthalen-2-ylethanamine |
| SMILES | CC(C)(C)CCOCC(N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H25NO/c1-18(2,3)10-11-20-13-17(19)16-9-8-14-6-4-5-7-15(14)12-16/h4-9,12,17H,10-11,13,19H2,1-3H3 |
| InChIKey | SWAWPITXFRXQJB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|