C15H24FNO2 — CID 107523803
2-(3,3-dimethylbutoxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 107523803) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | 2-(3,3-dimethylbutoxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 107523803 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(N)COCCC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H24FNO2/c1-15(2,3)7-8-19-10-13(17)11-5-6-14(18-4)12(16)9-11/h5-6,9,13H,7-8,10,17H2,1-4H3 |
| InChIKey | MGIDURWKJWWAAI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|