C14H22FNO3 — CID 107524139
2-(1-ethoxypropan-2-yloxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 107524139) has the molecular formula C14H22FNO3 and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-(1-ethoxypropan-2-yloxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | 2-(1-ethoxypropan-2-yloxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 107524139 |
| Molecular Formula | C14H22FNO3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-(1-ethoxypropan-2-yloxy)-1-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | CCOCC(C)OCC(N)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H22FNO3/c1-4-18-8-10(2)19-9-13(16)11-5-6-14(17-3)12(15)7-11/h5-7,10,13H,4,8-9,16H2,1-3H3 |
| InChIKey | UHNCXTWAMSTZQA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |