C14H14F3NO — CID 16780890
1-naphthalen-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 16780890) has the molecular formula C14H14F3NO and a molecular weight of 269.27 g/mol. Its IUPAC name is 1-naphthalen-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-naphthalen-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 16780890 |
| Molecular Formula | C14H14F3NO |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-naphthalen-2-yl-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | NC(COCC(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H14F3NO/c15-14(16,17)9-19-8-13(18)12-6-5-10-3-1-2-4-11(10)7-12/h1-7,13H,8-9,18H2 |
| InChIKey | SNDRPIQYURJEPZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |