C13H18F3NO2 — CID 16785577
1-(4-propan-2-yloxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 16785577) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-(4-propan-2-yloxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(4-propan-2-yloxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 16785577 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(4-propan-2-yloxyphenyl)-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CC(C)Oc1ccc(C(N)COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO2/c1-9(2)19-11-5-3-10(4-6-11)12(17)7-18-8-13(14,15)16/h3-6,9,12H,7-8,17H2,1-2H3 |
| InChIKey | YRGQEJWRLVEPPW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |