C19H24O — CID 115792765
3-cyclohexyl-1-naphthalen-2-ylpropan-1-ol (PubChem CID 115792765) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-cyclohexyl-1-naphthalen-2-ylpropan-1-ol.
| Compound Name | 3-cyclohexyl-1-naphthalen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 115792765 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-cyclohexyl-1-naphthalen-2-ylpropan-1-ol |
| SMILES | OC(CCC1CCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H24O/c20-19(13-10-15-6-2-1-3-7-15)18-12-11-16-8-4-5-9-17(16)14-18/h4-5,8-9,11-12,14-15,19-20H,1-3,6-7,10,13H2 |
| InChIKey | DCDPQVXOPSYSDS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |