C12H17F3N2O — CID 55055206
1-(3-aminophenyl)-2-[ethyl(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 55055206) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2-[ethyl(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 1-(3-aminophenyl)-2-[ethyl(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 55055206 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(3-aminophenyl)-2-[ethyl(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CCN(CC(O)c1cccc(N)c1)CC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O/c1-2-17(8-12(13,14)15)7-11(18)9-4-3-5-10(16)6-9/h3-6,11,18H,2,7-8,16H2,1H3 |
| InChIKey | DSCPMPNWDDGCCF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|