C15H18N2O — CID 12932007
1,3-bis(3-aminophenyl)propan-1-ol (PubChem CID 12932007) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,3-bis(3-aminophenyl)propan-1-ol.
| Compound Name | 1,3-bis(3-aminophenyl)propan-1-ol |
|---|---|
| PubChem CID | 12932007 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1,3-bis(3-aminophenyl)propan-1-ol |
| SMILES | Nc1cccc(CCC(O)c2cccc(N)c2)c1 |
| InChI | InChI=1S/C15H18N2O/c16-13-5-1-3-11(9-13)7-8-15(18)12-4-2-6-14(17)10-12/h1-6,9-10,15,18H,7-8,16-17H2 |
| InChIKey | HDGGGWZFYISQSC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|