C15H14F3NO2 — CID 106695922
1-(3-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]ethanol (PubChem CID 106695922) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 1-(3-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 106695922 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-(3-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]ethanol |
| SMILES | Nc1cccc(C(O)Cc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C15H14F3NO2/c16-15(17,18)21-13-6-4-10(5-7-13)8-14(20)11-2-1-3-12(19)9-11/h1-7,9,14,20H,8,19H2 |
| InChIKey | QXKDJPGTMMGKRK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|