C16H23NO4S — CID 67130320
[3-[3-(cyclopentylmethylsulfinyl)phenyl]-3-hydroxypropyl]carbamic acid (PubChem CID 67130320) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is [3-[3-(cyclopentylmethylsulfinyl)phenyl]-3-hydroxypropyl]carbamic acid.
| Compound Name | [3-[3-(cyclopentylmethylsulfinyl)phenyl]-3-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 67130320 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [3-[3-(cyclopentylmethylsulfinyl)phenyl]-3-hydroxypropyl]carbamic acid |
| SMILES | O=C(O)NCCC(O)c1cccc(S(=O)CC2CCCC2)c1 |
| InChI | InChI=1S/C16H23NO4S/c18-15(8-9-17-16(19)20)13-6-3-7-14(10-13)22(21)11-12-4-1-2-5-12/h3,6-7,10,12,15,17-18H,1-2,4-5,8-9,11H2,(H,19,20) |
| InChIKey | XWCQEGZBYDKUAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |