About [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid
[3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid (PubChem CID 90404964) has the molecular formula C16H23NO7S2
and a molecular weight of 405.49 g/mol. Its IUPAC name is [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid.
Molecular Properties
| Compound Name | [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid |
| PubChem CID | 90404964 |
| Molecular Formula | C16H23NO7S2 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid |
| SMILES | O=C(O)NCCC(O)c1cccc(S(=O)(=O)CC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C16H23NO7S2/c18-15(4-7-17-16(19)20)13-2-1-3-14(10-13)26(23,24)11-12-5-8-25(21,22)9-6-12/h1-3,10,12,15,17-18H,4-9,11H2,(H,19,20) |
| InChIKey | PNECIMBUTYYVAF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid?
The IUPAC name of [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid (CID 90404964) is [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid.
What is the SMILES notation for [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid?
The canonical SMILES for [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid is O=C(O)NCCC(O)c1cccc(S(=O)(=O)CC2CCS(=O)(=O)CC2)c1.
What is the InChIKey of [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid?
The InChIKey is PNECIMBUTYYVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO7S2/c18-15(4-7-17-16(19)20)13-2-1-3-14(10-13)26(23,24)11-12-5-8-25(21,22)9-6-12/h1-3,10,12,15,17-18H,4-9,11H2,(H,19,20).
What are the key properties of [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid?
[3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid has a molecular weight of 405.49 g/mol, XLogP of 0.98, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-[(1,1-dioxothian-4-yl)methylsulfonyl]phenyl]-3-hydroxypropyl]carbamic acid is sourced from PubChem (CID 90404964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).