C21H32FNO5S — CID 67130435
tert-butyl N-[3-[3-(cyclohexylmethylsulfonyl)-5-fluorophenyl]-3-hydroxypropyl]carbamate (PubChem CID 67130435) has the molecular formula C21H32FNO5S and a molecular weight of 429.55 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(cyclohexylmethylsulfonyl)-5-fluorophenyl]-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(cyclohexylmethylsulfonyl)-5-fluorophenyl]-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 67130435 |
| Molecular Formula | C21H32FNO5S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | tert-butyl N-[3-[3-(cyclohexylmethylsulfonyl)-5-fluorophenyl]-3-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)c1cc(F)cc(S(=O)(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C21H32FNO5S/c1-21(2,3)28-20(25)23-10-9-19(24)16-11-17(22)13-18(12-16)29(26,27)14-15-7-5-4-6-8-15/h11-13,15,19,24H,4-10,14H2,1-3H3,(H,23,25) |
| InChIKey | MEGPNVIWVYLLGY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |