C20H27NO4 — CID 66629363
tert-butyl N-[3-hydroxy-3-[3-[2-(1-hydroxycyclobutyl)ethynyl]phenyl]propyl]carbamate (PubChem CID 66629363) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-3-[3-[2-(1-hydroxycyclobutyl)ethynyl]phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-3-[3-[2-(1-hydroxycyclobutyl)ethynyl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 66629363 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl N-[3-hydroxy-3-[3-[2-(1-hydroxycyclobutyl)ethynyl]phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)c1cccc(C#CC2(O)CCC2)c1 |
| InChI | InChI=1S/C20H27NO4/c1-19(2,3)25-18(23)21-13-9-17(22)16-7-4-6-15(14-16)8-12-20(24)10-5-11-20/h4,6-7,14,17,22,24H,5,9-11,13H2,1-3H3,(H,21,23) |
| InChIKey | PDHWYTBWLAORGI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|