C20H34N2O3 — CID 67296648
tert-butyl N-[3-[3-(2-ethylbutylamino)phenyl]-3-hydroxypropyl]carbamate (PubChem CID 67296648) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(2-ethylbutylamino)phenyl]-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(2-ethylbutylamino)phenyl]-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 67296648 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl N-[3-[3-(2-ethylbutylamino)phenyl]-3-hydroxypropyl]carbamate |
| SMILES | CCC(CC)CNc1cccc(C(O)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H34N2O3/c1-6-15(7-2)14-22-17-10-8-9-16(13-17)18(23)11-12-21-19(24)25-20(3,4)5/h8-10,13,15,18,22-23H,6-7,11-12,14H2,1-5H3,(H,21,24) |
| InChIKey | VCFDGHFWMJZEJS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |