C21H36N2O5S — CID 67296362
tert-butyl N-[3-[3-(heptan-4-ylsulfonylamino)phenyl]-3-hydroxypropyl]carbamate (PubChem CID 67296362) has the molecular formula C21H36N2O5S and a molecular weight of 428.60 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(heptan-4-ylsulfonylamino)phenyl]-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(heptan-4-ylsulfonylamino)phenyl]-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 67296362 |
| Molecular Formula | C21H36N2O5S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | tert-butyl N-[3-[3-(heptan-4-ylsulfonylamino)phenyl]-3-hydroxypropyl]carbamate |
| SMILES | CCCC(CCC)S(=O)(=O)Nc1cccc(C(O)CCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H36N2O5S/c1-6-9-18(10-7-2)29(26,27)23-17-12-8-11-16(15-17)19(24)13-14-22-20(25)28-21(3,4)5/h8,11-12,15,18-19,23-24H,6-7,9-10,13-14H2,1-5H3,(H,22,25) |
| InChIKey | RQEBDOSSLIOHLY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |