C15H23NO3 — CID 139349481
tert-butyl N-[3-(4-hydroxybutan-2-yl)phenyl]carbamate (PubChem CID 139349481) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl N-[3-(4-hydroxybutan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-hydroxybutan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 139349481 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | tert-butyl N-[3-(4-hydroxybutan-2-yl)phenyl]carbamate |
| SMILES | CC(CCO)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H23NO3/c1-11(8-9-17)12-6-5-7-13(10-12)16-14(18)19-15(2,3)4/h5-7,10-11,17H,8-9H2,1-4H3,(H,16,18) |
| InChIKey | RSCZLKNZYYAVKH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |