C15H21ClN2O3 — CID 139349679
tert-butyl N-[3-(4-chloro-4-hydroxyiminobutan-2-yl)phenyl]carbamate (PubChem CID 139349679) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is tert-butyl N-[3-(4-chloro-4-hydroxyiminobutan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-chloro-4-hydroxyiminobutan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 139349679 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | tert-butyl N-[3-(4-chloro-4-hydroxyiminobutan-2-yl)phenyl]carbamate |
| SMILES | CC(CC(Cl)=NO)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-10(8-13(16)18-20)11-6-5-7-12(9-11)17-14(19)21-15(2,3)4/h5-7,9-10,20H,8H2,1-4H3,(H,17,19) |
| InChIKey | UGZRUPZGLYGGKX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|