C22H29NO3S — CID 67130399
tert-butyl N-[3-hydroxy-3-[3-(2-phenylethylsulfanyl)phenyl]propyl]carbamate (PubChem CID 67130399) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-3-[3-(2-phenylethylsulfanyl)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-3-[3-(2-phenylethylsulfanyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 67130399 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | tert-butyl N-[3-hydroxy-3-[3-(2-phenylethylsulfanyl)phenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(O)c1cccc(SCCc2ccccc2)c1 |
| InChI | InChI=1S/C22H29NO3S/c1-22(2,3)26-21(25)23-14-12-20(24)18-10-7-11-19(16-18)27-15-13-17-8-5-4-6-9-17/h4-11,16,20,24H,12-15H2,1-3H3,(H,23,25) |
| InChIKey | QTMJMAKYVJXWOV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |