C19H24ClNO3 — CID 11960999
tert-butyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate (PubChem CID 11960999) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 11960999 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | tert-butyl N-[4-[2-(3-chlorophenyl)ethynyl]-4-hydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)(C#Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H24ClNO3/c1-18(2,3)24-17(22)21-16-8-11-19(23,12-9-16)10-7-14-5-4-6-15(20)13-14/h4-6,13,16,23H,8-9,11-12H2,1-3H3,(H,21,22) |
| InChIKey | HJVQHZMSKMYBIT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|