C21H30Cl2N2O3 — CID 89367785
tert-butyl N-[[1-(3-chlorophenyl)-4-(3-chloropropanoylamino)cyclohexyl]methyl]carbamate (PubChem CID 89367785) has the molecular formula C21H30Cl2N2O3 and a molecular weight of 429.39 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-chlorophenyl)-4-(3-chloropropanoylamino)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(3-chlorophenyl)-4-(3-chloropropanoylamino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 89367785 |
| Molecular Formula | C21H30Cl2N2O3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | tert-butyl N-[[1-(3-chlorophenyl)-4-(3-chloropropanoylamino)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1(c2cccc(Cl)c2)CCC(NC(=O)CCCl)CC1 |
| InChI | InChI=1S/C21H30Cl2N2O3/c1-20(2,3)28-19(27)24-14-21(15-5-4-6-16(23)13-15)10-7-17(8-11-21)25-18(26)9-12-22/h4-6,13,17H,7-12,14H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | QYJHJGOPUCXSMS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|