C19H28ClNO5S — CID 87668985
[4-(3-chlorophenyl)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl] methanesulfonate (PubChem CID 87668985) has the molecular formula C19H28ClNO5S and a molecular weight of 417.96 g/mol. Its IUPAC name is [4-(3-chlorophenyl)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl] methanesulfonate.
| Compound Name | [4-(3-chlorophenyl)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 87668985 |
| Molecular Formula | C19H28ClNO5S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [4-(3-chlorophenyl)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCC1(c2cccc(Cl)c2)CCC(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H28ClNO5S/c1-18(2,3)25-17(22)21-13-19(14-6-5-7-15(20)12-14)10-8-16(9-11-19)26-27(4,23)24/h5-7,12,16H,8-11,13H2,1-4H3,(H,21,22) |
| InChIKey | XMVLCLDBMXDAHC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|