C21H25ClFNO5S — CID 86597131
[3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (PubChem CID 86597131) has the molecular formula C21H25ClFNO5S and a molecular weight of 457.95 g/mol. Its IUPAC name is [3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate.
| Compound Name | [3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| PubChem CID | 86597131 |
| Molecular Formula | C21H25ClFNO5S |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [3-[4-(3-chloro-4-fluorophenyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC(COS(C)(=O)=O)Cc1ccc(-c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H25ClFNO5S/c1-21(2,3)29-20(25)24-17(13-28-30(4,26)27)11-14-5-7-15(8-6-14)16-9-10-19(23)18(22)12-16/h5-10,12,17H,11,13H2,1-4H3,(H,24,25) |
| InChIKey | JYFVSYWBTRVDNQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|