C20H23ClFNO3 — CID 68867928
tert-butyl N-[(2R)-1-[4-(3-chloro-4-fluorophenyl)phenyl]-3-hydroxypropan-2-yl]carbamate (PubChem CID 68867928) has the molecular formula C20H23ClFNO3 and a molecular weight of 379.86 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4-(3-chloro-4-fluorophenyl)phenyl]-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4-(3-chloro-4-fluorophenyl)phenyl]-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 68867928 |
| Molecular Formula | C20H23ClFNO3 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4-(3-chloro-4-fluorophenyl)phenyl]-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)Cc1ccc(-c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23ClFNO3/c1-20(2,3)26-19(25)23-16(12-24)10-13-4-6-14(7-5-13)15-8-9-18(22)17(21)11-15/h4-9,11,16,24H,10,12H2,1-3H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | LQOOOYFEKPJQEO-MRXNPFEDSA-N |
| XLogP | 4.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |