C18H26ClNO5S — CID 86673935
[(1S,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate (PubChem CID 86673935) has the molecular formula C18H26ClNO5S and a molecular weight of 403.93 g/mol. Its IUPAC name is [(1S,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate.
| Compound Name | [(1S,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 86673935 |
| Molecular Formula | C18H26ClNO5S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [(1S,3S,4R)-3-(4-chlorophenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](OS(C)(=O)=O)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO5S/c1-18(2,3)24-17(21)20-16-10-9-14(25-26(4,22)23)11-15(16)12-5-7-13(19)8-6-12/h5-8,14-16H,9-11H2,1-4H3,(H,20,21)/t14-,15-,16+/m0/s1 |
| InChIKey | ATLOXESPCLDQMQ-HRCADAONSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|