C17H24ClNO3 — CID 86673936
tert-butyl N-[(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamate (PubChem CID 86673936) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 86673936 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | tert-butyl N-[(1R,2S,4S)-2-(4-chlorophenyl)-4-hydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](O)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClNO3/c1-17(2,3)22-16(21)19-15-9-8-13(20)10-14(15)11-4-6-12(18)7-5-11/h4-7,13-15,20H,8-10H2,1-3H3,(H,19,21)/t13-,14-,15+/m0/s1 |
| InChIKey | HBBJSPDKSDVETH-SOUVJXGZSA-N |
| XLogP | 3.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |