C15H21ClFNO3 — CID 106508924
tert-butyl N-[2-[(4-chloro-2-fluorophenyl)methyl]-3-hydroxypropyl]carbamate (PubChem CID 106508924) has the molecular formula C15H21ClFNO3 and a molecular weight of 317.79 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-chloro-2-fluorophenyl)methyl]-3-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-chloro-2-fluorophenyl)methyl]-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 106508924 |
| Molecular Formula | C15H21ClFNO3 |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | tert-butyl N-[2-[(4-chloro-2-fluorophenyl)methyl]-3-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(CO)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H21ClFNO3/c1-15(2,3)21-14(20)18-8-10(9-19)6-11-4-5-12(16)7-13(11)17/h4-5,7,10,19H,6,8-9H2,1-3H3,(H,18,20) |
| InChIKey | ZIWRTARYCQQFAT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |