C15H22FNO3 — CID 59847638
tert-butyl N-[4-(4-fluorophenyl)-2-hydroxybutyl]carbamate (PubChem CID 59847638) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is tert-butyl N-[4-(4-fluorophenyl)-2-hydroxybutyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-fluorophenyl)-2-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 59847638 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | tert-butyl N-[4-(4-fluorophenyl)-2-hydroxybutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FNO3/c1-15(2,3)20-14(19)17-10-13(18)9-6-11-4-7-12(16)8-5-11/h4-5,7-8,13,18H,6,9-10H2,1-3H3,(H,17,19) |
| InChIKey | WWHZLHDTTQWDCP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |