C18H17ClN2O4 — CID 68618684
1,2-oxazol-5-yl N-[(1R,3R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate (PubChem CID 68618684) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is 1,2-oxazol-5-yl N-[(1R,3R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate.
| Compound Name | 1,2-oxazol-5-yl N-[(1R,3R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 68618684 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1,2-oxazol-5-yl N-[(1R,3R)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate |
| SMILES | O=C(N[C@@H]1CCC[C@](O)(C#Cc2cccc(Cl)c2)C1)Oc1ccno1 |
| InChI | InChI=1S/C18H17ClN2O4/c19-14-4-1-3-13(11-14)6-9-18(23)8-2-5-15(12-18)21-17(22)24-16-7-10-20-25-16/h1,3-4,7,10-11,15,23H,2,5,8,12H2,(H,21,22)/t15-,18+/m1/s1 |
| InChIKey | FUNVVWKVFMTOCO-QAPCUYQASA-N |
| XLogP | 3.14 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|