C25H28ClNO4 — CID 66869398
N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-(2-phenylmethoxyethoxy)acetamide (PubChem CID 66869398) has the molecular formula C25H28ClNO4 and a molecular weight of 441.96 g/mol. Its IUPAC name is N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-(2-phenylmethoxyethoxy)acetamide.
| Compound Name | N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-(2-phenylmethoxyethoxy)acetamide |
|---|---|
| PubChem CID | 66869398 |
| Molecular Formula | C25H28ClNO4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]-2-(2-phenylmethoxyethoxy)acetamide |
| SMILES | O=C(COCCOCc1ccccc1)N[C@H]1CCC[C@@](O)(C#Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H28ClNO4/c26-22-9-4-8-20(16-22)11-13-25(29)12-5-10-23(17-25)27-24(28)19-31-15-14-30-18-21-6-2-1-3-7-21/h1-4,6-9,16,23,29H,5,10,12,14-15,17-19H2,(H,27,28)/t23-,25+/m0/s1 |
| InChIKey | APFVXKCPFIDUDS-UKILVPOCSA-N |
| XLogP | 3.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|