C22H20ClNO5 — CID 68618718
1,3-benzodioxol-2-yl N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate (PubChem CID 68618718) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is 1,3-benzodioxol-2-yl N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate.
| Compound Name | 1,3-benzodioxol-2-yl N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 68618718 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1,3-benzodioxol-2-yl N-[(1S,3S)-3-[2-(3-chlorophenyl)ethynyl]-3-hydroxycyclohexyl]carbamate |
| SMILES | O=C(N[C@H]1CCC[C@@](O)(C#Cc2cccc(Cl)c2)C1)OC1Oc2ccccc2O1 |
| InChI | InChI=1S/C22H20ClNO5/c23-16-6-3-5-15(13-16)10-12-22(26)11-4-7-17(14-22)24-20(25)29-21-27-18-8-1-2-9-19(18)28-21/h1-3,5-6,8-9,13,17,21,26H,4,7,11,14H2,(H,24,25)/t17-,22+/m0/s1 |
| InChIKey | JAUXTGQSSYUJMO-HTAPYJJXSA-N |
| XLogP | 3.85 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|